Lamibudina

konposatu kimiko

Lamibudina[1] alderantzizko transkriptasaren inhibitzaileen familiako antirretrobirala da. Erritonabirrarekin eta lopinabirrekin batera subterapeutiko gisa erabiltzen dute, GIB-1 eta GIB-2 bidez infektatutako pazienteentzako terapia antirretrobiral oso supresiboan. Zitidina nukleosidoaren analogoa da.

Lamibudina
Lamivudine structure.svg
Formula kimikoaC8H11N3O3S
SMILES kanonikoa2D eredua
SMILES isomerikoa
C1[C@H](O[C@H](S1)CO)N2C=CC(=NC2=O)N
MolView3D eredua
MotaAntibiriko, Bakterizida, nucleoside analogue (en) Itzuli eta pyrimidine (en) Itzuli
Masa molekularra229,052 Da
Erabilera
Konposatu aktiboaEpivir (en) Itzuli, Lamivudine Teva (en) Itzuli, Lamivudine Teva Pharma B.v. (en) Itzuli, Zeffix (en) Itzuli eta Epivir HBV (en) Itzuli
Tratatzen duHartutako Immuno Eskasiaren Sindromea, human immunodeficiency virus infectious disease (en) Itzuli, B hepatitis eta chronic hepatitis B (en) Itzuli
HaurdunaldiaAustralian pregnancy category B3 (en) Itzuli eta US pregnancy category C (en) Itzuli
Rolareverse-transcriptase inhibitor (en) Itzuli, anti-HIV agents (en) Itzuli eta farmako esentzial
Identifikatzaileak
InChlKeyJTEGQNOMFQHVDC-NKWVEPMBSA-N
CAS zenbakia134678-17-4
ChemSpider54812
PubChem60825
Reaxys5480511
Gmelin63577
ChEMBLCHEMBL141
RTECS zenbakiaUW7361333
DSSTox zenbakiaUW7361333
EC zenbakia603-844-3
ECHA100.132.250
MeSHD019259
RxNorm68244
Human Metabolome DatabaseHMDB0014847
UNII2T8Q726O95
NDF-RTN0000148418
KEGGD00353
PDB Ligand3TC
Ohar medikoa
Oharra: Wikipediak ez du mediku aholkurik ematen. Tratamendua behar duzula uste baduzu, jo ezazu sendagilearengana.

ErreferentziakAldatu

  1. Euskalterm: [Farmakoak Hiztegia] [2022]

Kanpo estekakAldatu


  Artikulu hau medikuntzari buruzko zirriborroa da. Wikipedia lagun dezakezu edukia osatuz.