Kloxazilina

konposatu kimiko

Kloxazilina[1] antibiotiko betalaktamikoa da, penizilina familiakoa. Bere ekintza-mekanismoa gainerako penizilinen antzekoa da, zelula-hormaren gainean jarduten du eta entzima batzuk inhibitzen ditu (transpeptidasak eta karboxipeptidasak), eta horrek peptidoglikanoaren sintesia eta bakterio-pareta zelularrerako beharrezkoak diren lotura gurutzatuak sortzea eragozten du.

Kloxazilina
Cloxacillin ball-and-stick.png
Formula kimikoaC19H18ClN3O5S
SMILES kanonikoa2D eredua
SMILES isomerikoa
CC1=C(C(=NO1)C2=CC=CC=C2Cl)C(=O)N[C@H]3[C@@H]4N(C3=O)[C@H](C(S4)(C)C)C(=O)O
InChl3D eredua
MotaBakterizida
Masa molekularra435,066 Da
Erabilera
Tratatzen dupneumonia bakteriano, infectious bone disease (en) Itzuli, goiko arnasbideetako infekzio, artropatia, postoperative complications (en) Itzuli, Osteomielitis, zelulitis, gernu-infekzio eta infekzio estafilokoziko
HaurdunaldiaUS pregnancy category B (en) Itzuli
RolaEntzimen inhibitzaile eta Bakterio-kontrako
Identifikatzaileak
InChlKeyLQOLIRLGBULYKD-JKIFEVAISA-N
CAS zenbakia61-72-3
ChemSpider5873
PubChem6098
Reaxys1232834
Gmelin49566
ChEMBLCHEMBL891
EC zenbakia200-514-7
ECHA100.000.468
MeSHD003023
RxNorm2625
Human Metabolome DatabaseHMDB0015278
UNIIO6X5QGC2VB
NDF-RTN0000147781
KEGGD07733
PDB LigandCXN

ErreferentziakAldatu

  1. Euskalterm: [Farmakoak Hiztegia] [2022]

Kanpo estekakAldatu


  Artikulu hau medikuntzari buruzko zirriborroa da. Wikipedia lagun dezakezu edukia osatuz.