Tagatosa

konposatu kimiko

Tagatosa formula duen monosakaridoa da, zetona taldea (C=O) bigarren karbonoan duena. Sei karbono dituenez hexosa bat da.

Tagatosa
Tagatose.png
Formula kimikoaC6H12O6
SMILES kanonikoa2D eredua
SMILES isomerikoa
C([C@H]([C@@H]([C@@H](C(=O)CO)O)O)O)O
InChl3D eredua
Osatutaoxigeno, karbono eta hidrogeno
TautomeroaD-tagatopyranose (en) Itzuli
Ezaugarriak
Fusio-puntua135 °C
Masa molekularra180,063 Da
Erabilera
Rolairon chelating agent (en) Itzuli
Arriskuak
NFPA 704
NFPA 704.svg
0
0
0
Identifikatzaileak
InChlKeyBJHIKXHVCXFQLS-PQLUHFTBSA-N
CAS zenbakia87-81-0
ChemSpider83142
PubChem92092
Reaxys1724555
Gmelin47693
EC zenbakia201-772-3
ECHA100.001.612
MeSHC030192
Human Metabolome DatabaseHMDB0003418
UNIIT7A20Y888Y
PDB LigandTAG

EzaugarriakAldatu

Sakarosaren gozotasunaren %92a dauka baina kalorien %38a baino ez.

ErabilerakAldatu

Indize gluzemiko oso txikia du. Konparazio batera sakarosaren indizea 68 da, fruktosarena 24 eta tagatosarena 3. Horrek diabetikoentzako azukre egokia bihurtzen du[1] eta edulkoratzaile gisa erabiltzen da.

Pisua jeisteko balio izateaz gain antioxidatzaile eraginkorra dela ere frogatu da.

ErreferentziakAldatu

  1. Portal Diabetes.net. 2008-05-05 (Noiz kontsultatua: 2018-11-03).


Kanpo estekakAldatu