Monosodio glutamato

konposatu kimiko

Monosodio glutamatoa edo sodio glutamatoa[1] azido glutamikoaren gatz sodikoa da, naturan esentzialak ez diren aminoazidorik ugarienetako bat.[2] Estatu Batuetako Elikagai eta Sendagaien Administrazioa seguru mailan sailkatu zuen eta Europar Batasunak elikagai-gehigarritzat hartzen du. Monosodio glutamatoaren glutamatoak beste elikagai batzuetan dagoen glutamatoaren umami zapore bera ematen du.[3]

Monosodio glutamato
Mononatrium-L-Glutamat.svg
MSG crystals.JPG
Formula kimikoaC5H8NNaO4
SMILES kanonikoa[O-)N.[Na+]&zoom=2.0&annotate=none 2D eredua]
SMILES isomerikoa
[H+].[Na+].N[C@@H](CCC([O-])=O)C([O-])=O
InChl3D eredua
Osatutaoxigeno, sodio, karbono, nitrogeno eta hidrogeno
Ezaugarriak
Fusio-puntua165 °C
Deskonposizio-puntua225 °C
Masa molekularra169,035 Da
Arriskuak
NFPA 704
NFPA 704.svg
0
0
0
Identifikatzaileak
InChlKeyLPUQAYUQRXPFSQ-DFWYDOINSA-M
CAS zenbakia142-47-2
ChemSpider76943
PubChem23672308
Reaxys17456768
Gmelin64243
ChEMBLCHEMBL2107256
RTECS zenbakiaMA1578000
ZVG492938
DSSTox zenbakiaMA1578000
EC zenbakia205-538-1
ECHA100.005.035
CosIng79487
MeSHD012970
RxNorm1313974
UNIIC3C196L9FG

ErreferentziakAldatu

  1. Euskalterm: [Hiztegi Terminologikoa] [2001]
  2. Ninomiya, K. (1998). «Natural occurrence» Food Reviews International 14 (2 & 3): 177–211. doi:10.1080/87559129809541157..
  3. Ikeda, K. (2002ko azaroa). «New seasonings» Chem Senses 27 (9): 847–849. doi:10.1093/chemse/27.9.847. PMID 12438213..

Kanpo estekakAldatu


  Artikulu hau kimikari buruzko zirriborroa da. Wikipedia lagun dezakezu edukia osatuz.