Galaktosamina

konposatu kimiko

Galaktosamina () galaktosaren deribatua den aminoazukre bat da.

Galaktosamina
Formula kimikoaC6H13NO5
SMILES kanonikoa2D eredua
SMILES isomerikoa
C([C@@H]1[C@@H]([C@@H]([C@H](C(O1)O)N)O)O)O
InChl3D eredua
Motakonposatu kimiko
Masa molekularra179,079 Da
Identifikatzaileak
InChlKeyMSWZFWKMSRAUBD-GASJEMHNSA-N
CAS zenbakia7535-00-4
ChemSpider22576
PubChem24154
Reaxys2042269
Gmelin60312
ChEMBLCHEMBL3304228
KEGGC02262

EzaugarriakAldatu

Galaktosaren bigarren karbonoko hidroxilo taldea (-OH) amina talde batek (-NH2) ordezkatu du.

Garrantzia biologikoaAldatu

Hainbat hormona glukoproteikoren osagaia da, Hormona folikulu estimulatzailearena (FSH) eta Hormona luteinizatzailearena (LH) esate baterako.

Molekula hepatotoxikoa ere bada, hau da, gibeleko zelulak kaltetzen ditu.

ErreferentziakAldatu

Kanpo estekakAldatu