Epsilon-karoteno

konposatu kimiko

ε-Karotenoa karoteno mota bat da.

Epsilon-karoteno
Formula kimikoaC40H56
SMILES kanonikoa2D eredua
SMILES isomerikoa
CC1=CCCC(C1/C=C/C(=C/C=C/C(=C/C=C/C=C(/C=C/C=C(/C=C/C2C(CCC=C2C)(C)C)\C)\C)/C)/C)(C)C
MolView3D eredua
Motabiogenic aliphatic hydrocarbon (en) Itzuli eta Karotenoide
Masa molekularra536,438202 Da
Identifikatzaileak
InChlKeyQABFXOMOOYWZLZ-JLTXGRSLSA-N
CAS zenbakia38894-81-4
ChemSpider393790
PubChem446439
Reaxys2067410
Gmelin32549
KNApSAcKC00022813
KEGGC16276

Kanpo estekak aldatu


  Artikulu hau zirriborroa da. Wikipedia lagun dezakezu edukia osatuz.