Flabina adenina dinukleotido

konposatu kimiko

Flabina adenina dinukleotidoa[1], FAD era laburtuan, zelula guztietan dagoen koentzima da, erredox erreakzioetan parte hartzen duena.

Flabina adenina dinukleotido
FAD.svg
Formula kimikoaC27H33N9O15P2
SMILES kanonikoa2D eredua
SMILES isomerikoa
CC1=CC2=C(C=C1C)N(C[C@H](O)[C@H](O)[C@H](O)COP(O)(=O)OP(O)(=O)OC[C@H]3O[C@H]([C@H](O)[C@@H]3O)N4C=NC5=C4N=CN=C5N)C6=NC(=O)NC(=O)C6=N2
InChl3D eredua
Osatutakarbono
Motacofactor (en) Itzuli
Masa molekularra785,157 Da
Identifikatzaileak
InChlKeyVWWQXMAJTJZDQX-UYBVJOGSSA-N
CAS zenbakia146-14-5
ChemSpider559059
PubChem643975
Reaxys1208946
Gmelin16238
ChEBI108834
ChEMBLCHEMBL1232653
EC zenbakia205-663-1
ECHA100.005.149
CosIng55905
MeSHD005182
RxNorm1314412
Human Metabolome DatabaseHMDB0001248
KNApSAcKC00001500
UNIIZC44YTI8KK
KEGGD00005 eta C00016
PDB LigandFAD

FADen funtzio biokimiko orokorra alkeno gisa alkanoak oxidatzea da, eta NAD+ak (antzeko funtzioa duen koenzima bat), berriz, alkoholak aldehidoetara edo zetonetara oxidatzea. Izan ere, alkano baten oxidazioa (sukzinatoa bezala) alkeno bati (fumaratoa bezala) FADH2ra erreduzitzeko bezain exergonikoa da, baina ez NAD+ NADHra erreduzitzeko.

ErreferentziakAldatu

  1. Euskalterm: [Hiztegi terminologikoa] [2009]

Kanpo estekakAldatu