Azido alfa-linoleniko: berrikuspenen arteko aldeak

Ezabatutako edukia Gehitutako edukia
t Robota: Testu aldaketa automatikoa (-cite journal +erreferentzia)
No edit summary
Etiketa: 2017 wikitestu editorearekin
1. lerroa:
{{konposatu kimiko infotaula}}
{{chembox
| Watchedfields = changed
| verifiedrevid = 477319349
| Name = α-Linolenic acid
| ImageFile = ALAnumbering.svg
| ImageSize = 250px
| ImageFile1 = Linolenic-acid-3D-vdW.png
| ImageSize1 = 250px
| IUPACName = Azido (9''Z'',12''Z'',15''Z'')-oktadeka-9,12,15-trienoikoa<ref>{{erreferentzia | last1 = Loreau | first1 = O | last2 = Maret | first2 = A | last3 = Poullain | first3 = D | last4 = Chardigny | first4 = JM | last5 = Sébédio | first5 = JL | last6 = Beaufrère | first6 = B | last7 = Noël | first7 = JP | title = Large-scale preparation of (9Z,12E)-1-(13)C-octadeca-9,12-dienoic acid, (9Z,12Z,15E)-1-(13)C-octadeca-9,12,15-trienoic acid and their 1-(13)C all-cis isomers | journal = Chemistry and physics of lipids | volume = 106 | issue = 1 | pages = 65–78 | year = 2000 | pmid = 10878236 | doi = 10.1016/S0009-3084(00)00137-7}}</ref>
| OtherNames = ALA; LNA; Azido linolenikoa; Azido ''cis'',''cis'',''cis''-9,12,15-oktadekatrienoikoa; Azido (9''Z'',12''Z'',15''Z'')-9,12,15-oktadekatrienoikoa; Industrene 120
| Section1 = {{Chembox Identifiers
| IUPHAR_ligand = 1049
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4444437
| PubChem = 5280934
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 0RBV727H71
| InChI = 1/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h3-4,6-7,9-10H,2,5,8,11-17H2,1H3,(H,19,20)/b4-3-,7-6-,10-9-
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 27432
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00132
| SMILES = O=C(O)CCCCCCC\C=C/C\C=C/C\C=C/CC
| InChIKey = DTOSIQBPPRVQHS-PDBXOOCHBH
| SMILES1 = CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)O
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 8739
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h3-4,6-7,9-10H,2,5,8,11-17H2,1H3,(H,19,20)/b4-3-,7-6-,10-9-
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = DTOSIQBPPRVQHS-PDBXOOCHSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 463-40-1
}}
| Section2 = {{Chembox Properties
| C = 18 | H = 30 | O = 2
| Density = 0.9164 g/cm<sup>3</sup>
| MeltingPt =
| BoilingPt =
}}
}}
[[Fitxategi:Seed of chia (Salvia hispanica)Salvia hispanica group.jpg|250px|eskuinera|thumb|[[Salvia hispanica|Txia]] haziak.]]
'''Azido alfa-linolenikoa''' edo '''Azido 9,12,15-oktadekatrienoikoa''' edo '''ALA''' kate luzeko [[gantz-azido]] poliasegabe bat da, <chem>C18H30O2</chem> formula duena. Giza gorputzak bere kabuz sintetizatzerik ez duenez janariaren bidez hartu behar da.