Kolekaltziferol

konposatu kimiko

Kolekaltziferola edo D3 bitamina D bitaminaren mota bat da. Ezinbestekoa da kaltzioa eta fosforoa hezurretan finkatzeko.[1] Organismoak bi bidetatik lor dezake: larruazaleko sintesia, eguzki-argiaren izpi ultramoreek 7-dehidrokolesterolean eragiten duten ekintzagatik, edo digestio-bidea, hura duten elikagaiak hartuz. Kolekaltziferola, gibelean hidroxilazio bidez, 25-hidroxikolekaltziferol (kaltzidiola) bihurtzen da. Hau, berriz ere, giltzurrunean hidroxilatzen denean, 1-25 dihidroxikolekalziferola (kaltzitriola) sortzen du.[2] D bitaminaren eskasia prebenitzeko sendagai gisa erabiltzen dute.[3]

Kolekaltziferol
Cholecalciferol2.svg
Formula kimikoaC27H44O
SMILES kanonikoa2D eredua
SMILES isomerikoa
C[C@H](CCCC(C)C)[C@H]1CC[C@@H]\2[C@@]1(CCC/C2=C\C=C/3\C[C@H](CCC3=C)O)C
InChl3D eredua
MotaD3 vitamins (en) Itzuli
Masa molekularra384,339216 Da
Erabilera
Tratatzen duminbizi, osteoporosi, gaixotasun kardiobaskular, giltzurrun-gutxiegitasun kroniko, skin benign neoplasm (en) Itzuli, larruazaleko gaixotasun, lung benign neoplasm (en) Itzuli, acropustulosis (en) Itzuli eta Crohn's colitis (en) Itzuli
HaurdunaldiaUS pregnancy category A (en) Itzuli
Rolabone density conservation agents (en) Itzuli eta Bitamina
Identifikatzaileak
InChlKeyQYSXJUFSXHHAJI-YRZJJWOYSA-N
CAS zenbakia67-97-0
ChemSpider4444353
PubChem5280795
Reaxys2339331
Gmelin28940
ChEBI1267613
ChEMBLCHEMBL1042
ZVG100386
EC zenbakia200-673-2
ECHA100.000.612
MeSHD002762
RxNorm2418
Human Metabolome DatabaseHMDB0000876
UNII1C6V77QF41
NDF-RTN0000146043
KEGGD00188

ErreferentziakAldatu

  1. D bitamina. in: ZTH zientzia eta teknologiaren hiztegi entziklopedikoa..
  2. «D bitamina helduengan: gainbaloratuta dago?» NFAC: 2..
  3. (Ingelesez) Coulston, Ann M.; Boushey, Carol; Ferruzzi, Mario. (2013). Nutrition in the Prevention and Treatment of Disease. Academic Press, 818 or. ISBN 9780123918840..

Kanpo estekakAldatu


  Artikulu hau medikuntzari buruzko zirriborroa da. Wikipedia lagun dezakezu edukia osatuz.