Hiosziamina

konposatu kimiko

Hiosziamina (C17H23NO3) belladonatik, estramoniotik eta beste landare solanazeo batzuetatik ateratzen den alkaloide pozoitsua da. Azido tropikoak eta tropinak osatutako esterea da. Begi-ninia zabaltzeko erabiltzen da batez ere.

Hiosziamina
Formula kimikoaC17H23NO3
SMILES kanonikoa2D eredua
SMILES isomerikoa
CN1[C@H]2CC[C@@H]1C[C@@H](C2)OC(=O)[C@H](CO)C3=CC=CC=C3
MolView3D eredua
KonposizioaNitrogeno eta karbono
MotaPharmakon1600-01500346 (en) Itzuli eta (±)-hyoscyamine (en) Itzuli
Estereoisomeroa[[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl (2R)-3-hydroxy-2-phenylpropanoate|(1R,5S)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl (2R)-3-hydroxy-2-phenylpropanoate]] (en) Itzuli, (+)-hyoscyamine (en) Itzuli, [[(2S)-3-hydroxy-2-phenylpropanoic acid [(1R,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] ester|(2S)-3-hydroxy-2-phenylpropanoic acid [(1R,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] ester]] (en) Itzuli, endo/exo-hyoscyamine (en) Itzuli, [[8-methyl-8-azabicyclo[3.2.1]octan-3-yl (2R)-3-hydroxy-2-phenylpropanoate|8-methyl-8-azabicyclo[3.2.1]octan-3-yl (2R)-3-hydroxy-2-phenylpropanoate]] (en) Itzuli eta [[(S)-((1R,3r,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 3-hydroxy-2-phenylpropanoate|(S)-((1R,3r,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 3-hydroxy-2-phenylpropanoate]] (en) Itzuli
Masa molekularra289,369 Da
Erabilera
Tratatzen dudardara, Enteropatia, neurogenic bladder (en) Itzuli, koliko, muskuluetako arranpa, gehiegizko listu-jariatze, errinitis, Ultzera peptiko, hiperhidrosi eta heste minberaren sindrome
Rolamuscarinic antagonist (en) Itzuli, antihistaminiko, serotonin antagonist (en) Itzuli, antiarrhythmic agent (en) Itzuli, Bronkozabaltzaile, parasympatholytic (en) Itzuli, mydriatic (en) Itzuli eta anesthesia adjuvants (en) Itzuli
Identifikatzaileak
InChlKeyRKUNBYITZUJHSG-FXUDXRNXSA-N
CAS zenbakia101-31-5
ChemSpider10246417
Reaxys91259
Gmelin17486
ChEMBLCHEMBL1331216
ZVG510260
EC zenbakia202-933-0
ECHA100.002.667
MeSHD064692
RxNorm153970
KNApSAcKC00002293
UNIIPX44XO846X
NDF-RTN0000146727
KEGGC02046
PDB LigandHYO

Erreferentziak aldatu

Kanpo estekak aldatu


  Artikulu hau kimikari buruzko zirriborroa da. Wikipedia lagun dezakezu edukia osatuz.