Hematoxilina

konposatu kimiko

Hematoxilina gai solido hori azukreduna da, C16H14O6 formula duena. Disoluzioan dauden hidroxidoei kolore urdina ematen die eta azidoei horia. Zitologian eta histologian erabiltzen diren gai asko prestatzeko erabiltzen da, aztertu nahi diren organo txikiei eta egiturei kolorea emateko, adibidez.[1]

Hematoxilina
Hämatoxylin.svg
Haematoxylin powder.jpg
Formula kimikoaC16H14O6
SMILES kanonikoa2D eredua
SMILES isomerikoa
C1C2=CC(=C(C=C2[C@H]3[C@@]1(COC4=C3C=CC(=C4O)O)O)O)O
InChl3D eredua
Ezaugarriak
Fusio-puntua140 °C
Masa molekularra302,079038 Da
Erabilera
RolaTindu
Identifikatzaileak
InChlKeyWZUVPPKBWHMQCE-XJKSGUPXSA-N
CAS zenbakia517-28-2
ChemSpider390940
PubChem442514
Reaxys1688573
Gmelin5601
ChEMBLCHEMBL477197
ZVG104584
EC zenbakia208-237-3
ECHA100.007.490
MeSHD006416
KNApSAcKC00002993
UNIIYKM8PY2Z55
KEGGC09931

ErreferentziakAldatu

Kanpo estekakAldatu


  Artikulu hau kimikari buruzko zirriborroa da. Wikipedia lagun dezakezu edukia osatuz.