Guanosina

Guaninaren nukleosidoa, erribosa bat lotua duena

Guanosina guanina eta erribosa azukrea duen gai konposatua da.[1] Berez nukleosido bat da.

Guanosina
Guanosin.svg
Formula kimikoaC10H13N5O5
SMILES kanonikoa2D eredua
SMILES isomerikoa
C1=NC2=C(N1[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)NC(=NC2=O)N
InChl3D eredua
Masa molekularra283,092 Da
Identifikatzaileak
InChlKeyNYHBQMYGNKIUIF-UUOKFMHZSA-N
CAS zenbakia118-00-3
ChemSpider6544
PubChem6802
Reaxys625911
Gmelin16750
ChEBI55323
ChEMBLCHEMBL375655
EC zenbakia204-227-8
ECHA100.003.844
CosIng34176
MeSHD006151
RxNorm1591890
Human Metabolome DatabaseHMDB0000133
KNApSAcKC00019679
UNII12133JR80S
KEGGC00387
PDB LigandGMP

Guanosina fosforilatzen denean nukleotido bat sortzen da (guanosina monofosfatoa -GMP-, guanosina difosfatoa -GDP- edo guanosina trifosfatoa -GTP- fosfato talde bat, bi edo hiru -hurrenez hurren- lotzen direnean).

Guanosina desoxirribosa bati lotzen zaionean desoxiguanosina nukleosidoa sortzen da.

Bere pisu molekularra 283,241 daltonekoa da eta bere egitura kimikoak antz handia du aziklobir botika antibiralarekin


ErreferentziakAldatu

Kanpo estekakAldatu


  Artikulu hau kimikari buruzko zirriborroa da. Wikipedia lagun dezakezu edukia osatuz.