Eskualeno

Kolesterola eta gainerako esteroideen biosintesiko aitzindarietako bat den hidrokarburo asegabea

Eskualenoa formula duen triterpenoa da.

Eskualeno
Squalene.svg
Formula kimikoaC30H50
SMILES kanonikoa2D eredua
SMILES isomerikoa
CC(=CCC/C(=C/CC/C(=C/CC/C=C(/CC/C=C(/CCC=C(C)C)\C)\C)/C)/C)C
InChl3D eredua
Osatutakarbono eta hidrogeno
Ezaugarriak
Fusio-puntua−75 °C
Masa molekularra410,391 Da
Arriskuak
NFPA 704
NFPA 704.svg
1
1
0
Identifikatzaileak
InChlKeyYYGNTYWPHWGJRM-AAJYLUCBSA-N
CAS zenbakia111-02-4
ChemSpider553635
PubChem638072
Reaxys1728920
Gmelin15440
ChEMBLCHEMBL458402
RTECS zenbakiaXB6010000
ZVG492751
DSSTox zenbakiaXB6010000
EC zenbakia203-826-1
ECHA100.003.479
CosIng78861
MeSHD013185
RxNorm253201
Human Metabolome DatabaseHMDB0000256
KNApSAcKC00003755
UNII7QWM220FJH
KEGGC00751
PDB LigandSQL

Jatorria eta ekoizpen industrialaAldatu

 
Marrazoaren gibeleko olioa, kapsulatan.

Marrazoen (Squalidae) gibeleko oliotik aterata komertzializatu zen aurrenekoz eta hortik datorkio izena. Landareetan ere aurkitzen da, arroz, gari eta amarantoan besteak beste. Gizakiok ere ekoizten dugu, bereziki hatz puntetan.

Eskualeno tona bat ekoizteko 3.000 marrazo behar direnez, gaur egungo ekoizpena genetikoki moldaturiko Saccharomyces cerevisiae legamia erabiltzen da. Honek eskualanoa ekoizten du, eskualenoaren antzeko ezaugarriak ditu, baina hidrogenoz asea dagoenez zailagoa da oxidatzen[1].

Arrain kondriktioek (marrazo eta arraiek) igeri-maskuririk ez dutenez gibelean eskualenoa pilatzen dute, itsasoko urak baino dentsitate txikiagoa duenez (0,88 g/cm3) flotagarritasuna lortzeko. Gibelak animalia osoaren laurdena har dezake.

Garrantzi biologikoaAldatu

Eskualenoa triterpeno lineala da. Izaki bizidunetan esteroideak ekoizteko bitartekaria da, izan ere eskualenoa ziklatzen denean ziklopentanoperhidrofenantrenoa eratzen da eta hau oinarri hartuta osatzen dira gainerako esteroideak[2]. Esteroideen artean aurreneko molekula lanosterola da.

 
Eskualenoaren eta lanosterolaren ekoizpena.

ErabilerakAldatu

Gripearen eta paludismoaren aurkako txertoetan erabiltzen da, inmunitate erantzuna handitzen baitu[3].

Kosmetikoetan ere erabiltzen da, larruazala lubrikatu eta babestu egiten baitu[4].

ErreferentziakAldatu

  1. (Ingelesez) ServickOct. 15, Kelly; 2015; Pm, 5:30. (2015-10-15). «Four synthetic biology inventions that flummox the feds» Science | AAAS (Noiz kontsultatua: 2018-12-30).
  2. www.tandfonline.com doi:10.3109/10409238309102790. (Noiz kontsultatua: 2018-12-30).
  3. (Ingelesez) Pollack, Andrew. (2009-09-21). «Experts Debate Use of Vaccine Booster» The New York Times ISSN 0362-4331. (Noiz kontsultatua: 2018-12-30).
  4. www.tandfonline.com doi:10.4161/derm.1.2.7811. (Noiz kontsultatua: 2018-12-30).


Kanpo estekakAldatu