Wikipedia

Trehalosa: berrikuspenen arteko aldeak

Nabigazio historia interaktiboa
← Aurreko ezberdintasunaHurrengo ezberdintasuna →
Ezabatutako edukia Gehitutako edukia
IkusizkoaWikitestua
t Robota: Testu aldaketa automatikoa (-[Cc]ite[ _]book +erreferentzia)
t Robota: Testu aldaketa automatikoa (-\{\{(.*\n)*\}\}\n\n\'\'\' +{{konposatu kimiko infotaula}}\n''')
1. lerroa:
{{konposatu kimiko infotaula}}
{{Chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 477174498
| ImageFile_Ref = {{chemboximage|correct|??}}
| ImageFile = Trehalose.svg
| ImageSize =
| ImageFile1 = Trehalose-from-xtal-2008-CM-3D-balls.png
| ImageFile2 = Trehalose-from-xtal-2008-CM-3D-SF.png
| OtherNames = α,α‐Trehalosa; α-<small>D</small>-glukopiranosil-(1→1)-α-<small>D</small>-glukopiranosidoa
| IUPACName = (2''R'',3''S'',4''S'',5''R'',6''R'')-2-(Hydroxymethyl)-6-[(2''R'',3''R'',4''S'',5''S'',6''R'')-3,4,
5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-3,4,5-triol
|Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 7149
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1236395
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = B8WCK70T7I
| InChI = 1/C12H22O11/c13-1-3-5(15)7(17)9(19)11(21-3)23-12-10(20)8(18)6(16)4(2-14)22-12/h3-20H,1-2H2/t3-,4-,5-,6-,7+,8+,9-,10-,11-,12-/m1/s1
| InChIKey = HDTRYLNUVZCQOY-LIZSDCNHBN
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 16551
| SMILES = OC[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H](O1)O[C@@H]2[C@H](O)[C@@H](O)[C@H](O)[C@H](O2)CO
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C12H22O11/c13-1-3-5(15)7(17)9(19)11(21-3)23-12-10(20)8(18)6(16)4(2-14)22-12/h3-20H,1-2H2/t3-,4-,5-,6-,7+,8+,9-,10-,11-,12-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = HDTRYLNUVZCQOY-LIZSDCNHSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 99-20-7
| CASNo_Comment = (anhydrous)
| CASNo1_Ref = {{cascite|changed|??}}
| CASNo1 = 6138-23-4
| CASNo1_Comment = (dihydrate)
| PubChem = 7427
| RTECS =
}}
|Section2={{Chembox Properties
| Formula = C<sub>12</sub>H<sub>22</sub>O<sub>11</sub> (anhidridoa)
| MolarMass = 342.296 g/mol (anhidroa)<br />378.33 g/mol (dihidratoa)
| Appearance = kristal ortorronbiko zuriak
| Density = 1.58 g/cm<sup>3</sup> 24 °C-tan
| MeltingPtC = 203
| MeltingPt_notes = (anhidroa)<br />97°C (dihidratoa)
| BoilingPt =
| BoilingPt_notes =
| Solubility = 68.9 g/100&nbsp;g 20°C-tan<ref>{{erreferentzia|url=http://www.iupac.org/publications/pac/2002/pdf/7407x1263.pdf |journal= Pure Appl. Chem. |volume=74|issue=7|pages=1263–1269|year=2002|doi=10.1351/pac200274071263|title=Novel functions and applications of trehalose|last1=Higashiyama|first1=Takanobu}}</ref>
| SolubleOther = [[etanol]]ean disolbagarria, [[dietil eter]] eta [[bentzeno]]an ez<ref name="hand">{{erreferentzia
| last = Lide
| first = David R.
| publication-date =
| year = 1998
| title = Handbook of Chemistry and Physics
| edition = 87
| volume =
| series =
| publication-place = Boca Raton, Florida
| place =
| publisher = CRC Press
| id =
| isbn = 0-8493-0594-2
| doi =
| oclc =
| pages = 3–534
| url =
| accessdate =
| postscript = <!--None-->
}}</ref>
| Solvent =
| pKa =
| pKb =
}}
|Section3={{Chembox Structure
| CrystalStruct =
| Coordination =
| MolShape =
}}
|Section4={{Chembox Thermochemistry
| DeltaHf =
| DeltaHc =
| Entropy =
| HeatCapacity =
}}
|Section5={{Chembox Pharmacology
| AdminRoutes =
| Bioavail =
| Metabolism =
| HalfLife =
| ProteinBound =
| Excretion =
| Legal_status =
| Legal_US =
| Legal_UK =
| Legal_AU =
| Legal_CA =
| PregCat =
| PregCat_AU =
| PregCat_US =
}}
|Section6={{Chembox Explosive
| ShockSens =
| FrictionSens =
| DetonationV =
| REFactor =
}}
|Section7={{Chembox Hazards
| ExternalSDS =
| EUClass =
| MainHazards =
| NFPA-H =
| NFPA-F =
| NFPA-R =
| NFPA-S =
| RPhrases =
| SPhrases =
| RSPhrases =
| FlashPt =
| AutoignitionPt =
| ExploLimits =
| PEL =
}}
|Section8={{Chembox Related
| OtherAnions =
| OtherCations =
| OtherFunction =
| OtherFunction_label =
| OtherCompounds =
}}
}}
 
'''Trehalosa''' bi [[glukosa]]z osaturiko [[disakarido]]a da.
 
"https://eu.wikipedia.org/wiki/Trehalosa"(e)tik eskuratuta