«Lanosterol»: berrikuspenen arteko aldeak

1.629 bytes removed ,  Duela 7 hilabete
t
Robota: Testu aldaketa automatikoa (-\{\{(.*\n)*\}\}\n\'\'\' +{{konposatu kimiko infotaula}}\n''')
t (Robota: Testu aldaketa automatikoa (-\{\{(.*\n)*\}\}\n\'\'\' +{{konposatu kimiko infotaula}}\n'''))
{{konposatu kimiko infotaula}}
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 393354387
| ImageFile = Lanosterol skeletal.svg
| ImageSize = 250
| ImageFile2 = Lanosterol molecule ball.png
| ImageSize2 = 250
| ImageAlt2 = Ball-and-stick model of lanosterol
| IUPACName = lanosta-8,24-dien-3-ol
| OtherNames =
|Section1={{Chembox Identifiers
| IUPHAR_ligand = 2746
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 79-63-0
| PubChem = 246983
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 16521
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 225111
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII = 1J05Z83K3M
| SMILES = C[C@H](CCC=C(C)C)[C@H]1CC[C@]2(C)C1CCC3=C2CC[C@H]4C(C)(C)[C@@H](O)CC[C@]34C
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 216175
| InChI = 1/C30H50O/c1-20(2)10-9-11-21(3)22-14-18-30(8)24-12-13-25-27(4,5)26(31)16-17-28(25,6)23(24)15-19-29(22,30)7/h10,21-22,25-26,31H,9,11-19H2,1-8H3/t21-,22-,25+,26+,28-,29-,30+/m1/s1
| InChIKey = CAHGCLMLTWQZNJ-BQNIITSRBP
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C30H50O/c1-20(2)10-9-11-21(3)22-14-18-30(8)24-12-13-25-27(4,5)26(31)16-17-28(25,6)23(24)15-19-29(22,30)7/h10,21-22,25-26,31H,9,11-19H2,1-8H3/t21-,22-,25+,26+,28-,29-,30+/m1/s1
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = CAHGCLMLTWQZNJ-BQNIITSRSA-N
| MeSHName = Lanosterol
}}
|Section2={{Chembox Properties
| Formula = C<sub>30</sub>H<sub>50</sub>O
| MolarMass = 426.71 g/mol
| Appearance =
| Density =
| MeltingPtC = 138-140
| MeltingPt_notes =
| BoilingPt =
}}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
'''Lanosterola''' [[esterol]]en saileko [[alkohol]]a da (C<sub>28</sub>H<sub>44</sub>O). Mutur batean daukan hidroxilo taldeari esker [[molekula anfipatiko]]a da.