«Isomaltosa»: berrikuspenen arteko aldeak

1.371 bytes removed ,  Duela 2 urte
t
Robota: Testu aldaketa automatikoa (-\{\{(.*\n)*\}\}\n\'\'\' +{{konposatu kimiko infotaula}}\n''')
t (Robota: Testu aldaketa automatikoa (-[Cc]ite[ _]book +erreferentzia))
t (Robota: Testu aldaketa automatikoa (-\{\{(.*\n)*\}\}\n\'\'\' +{{konposatu kimiko infotaula}}\n'''))
{{konposatu kimiko infotaula}}
{{Chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 477168646
| ImageFile = Isomaltose structure.svg
| ImageSize =
| PIN = Isomaltosa
| SystematicName = 6-''O''-α-<small>D</small>-Glukopiranosil-<small>D</small>-glukopiranosa
| OtherNames=''O''-α-<small>D</small>-glukopiranosil-α[1-6]-α-<small>D</small>-glukopiranosidoa
|Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 388333
| InChI = 1/C12H22O11/c13-1-3-5(14)8(17)10(19)12(23-3)21-2-4-6(15)7(16)9(18)11(20)22-4/h3-20H,1-2H2/t3-,4-,5-,6-,7+,8+,9-,10-,11?,12+/m1/s1
| InChIKey = DLRVVLDZNNYCBX-RTPHMHGBBU
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C12H22O11/c13-1-3-5(14)8(17)10(19)12(23-3)21-2-4-6(15)7(16)9(18)11(20)22-4/h3-20H,1-2H2/t3-,4-,5-,6-,7+,8+,9-,10-,11?,12+/m1/s1
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = DLRVVLDZNNYCBX-RTPHMHGBSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 499-40-1
| PubChem = 439193
| MeSHName = Isomaltosa
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 28189
| SMILES = O(C[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O)[C@H]2O[C@@H]([C@@H](O)[C@H](O)[C@H]2O)CO
}}
|Section2={{Chembox Properties
| C=12 | H=22 | O=11
| Appearance=
| Density=
| MeltingPt=
| BoilingPt=
| Solubility=
}}
|Section3={{Chembox Hazards
| MainHazards=
| FlashPt=
| AutoignitionPt =
}}
}}
'''Isomaltosa''' ernetako [[garagar]] aletan dagoen [[disakarido]]a da, bi [[glukosa]] molekulaz osaturikoa.