«Estriknina»: berrikuspenen arteko aldeak

2.053 bytes removed ,  Duela 2 urte
ez dago edizio laburpenik
t (Autoritate kontrola jartzea)
No edit summary
Etiketa: 2017 wikitestu editorearekin
{{konposatu kimiko infotaula}}
| Verifiedfields = changed
| verifiedrevid = 442182608
|Section1= {{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 389877
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = H9Y79VD43J
| InChI = 1/C21H22N2O2/c24-18-10-16-19-13-9-17-21(6-7-22(17)11-12(13)5-8-25-16)14-3-1-2-4-15(14)23(18)20(19)21/h1-5,13,16-17,19-20H,6-11H2/t13-,16-,17-,19-,20-,21+/m0/s1
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C21H22N2O2/c24-18-10-16-19-13-9-17-21(6-7-22(17)11-12(13)5-8-25-16)14-3-1-2-4-15(14)23(18)20(19)21/h1-5,13,16-17,19-20H,6-11H2/t13-,16-,17-,19-,20-,21+/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo=57-24-9
| CASNo_comment = (base)
| CASNo1 = 60-41-3
| CASNo1_comment = (sulfate)
| PubChem=441071
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 227934
| ChEMBL2 = 612118
| ChEMBL3 = 486399
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = C06522
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 28973
| SMILES = O=C7N2c1ccccc1[C@@]64[C@@H]2[C@@H]3[C@@H](OC/C=C5\[C@@H]3C[C@@H]6N(CC4)C5)C7
|Section2= {{Chembox Properties
| Formula=C<sub>21</sub>H<sub>22</sub>N<sub>2</sub>O<sub>2</sub>
| MolarMass=334.41 g mol<sup>−1</sup>
| ElementalAnalysis=C:75.42%,<br />H:6.63%,<br />N:8.38%,<br />O:9.57%
| Colour=White or translucent
| State/form=Cristal or crystilline powder
| Odor=Odorless
| Appearance=
| Density=1.36 g cm<sup>−3</sup>
| VaporDensity=11.0
| VaporPressure at 20[[celsius gradu|°C]]=0 torr
| Explosiveness=Stable
| pH of saturated solution=9.5
| MeltingPt=557−559 [[Kelvin (unitatea)|K]] (284−286 [[celsius gradu|°C]])
| BoilingPt=543 [[Kelvin (unitatea)|K]] (270 [[celsius gradu|°C]])
| Taste=Bitter
|Section3= {{Chembox Hazards
| MainHazards=
| FlashPt=
| Autoignition=
'''Estriknina''' [[alkaloide]] [[pozoi]]tsua da, oso eraginkorra. ''[[Strichnos ignoteii]]'' zuhaixkatik eta ''[[Strichnos muxvomica]]'' zuhaitzetik ateratzen da. [[Txakur|Zakurrak]], [[arratoi]]ak, etab. hiltzeko gaiak egiteko erabiltzen da. Heste-aringarrietan ere erabiltzen da, baina dosi handietan kaltegarria da; 100 eta 300 mg bitarteko dosiak heriotza ekar dezake.
== Erreferentziak ==