«Kortisol»: berrikuspenen arteko aldeak

1.047 bytes removed ,  Duela 10 hilabete
ez dago edizio laburpenik
t (Autoritate kontrola jartzea)
Etiketa: 2017 wikitestu editorearekin
{{konposatu kimiko infotaula}}
| IUPACName = 11β,17α,21-trihidroxipregn-4-eno-3,20-diono
| ImageFile = Cortisol2.svg
| ImageSize =
| ImageFile1 = Cortisol-3D-balls.png
| ImageSize1 =
| Section1 = {{Chembox Identifiers
| CASNo = 50-23-7
| PubChem = 5754
| DrugBank = DB00741
| ChemSpiderID = 5551
| ChemSpiderID_Comment =
| KEGG = D00088
| ChEBI = 17650
| ChEMBL = 389621
| SMILES = O=C4\C=C2/[C@]([C@H]1[C@@H](O)C[C@@]3([C@@](O)(C(=O)CO)CC[C@H]3[C@@H]1CC2)C)(C)CC4
| StdInChI = 1S/C21H30O5/c1-19-7-5-13(23)9-12(19)3-4-14-15-6-8-21(26,17(25)11-22)20(15,2)10-16(24)18(14)19/h9,14-16,18,22,24,26H,3-8,10-11H2,1-2H3/t14-,15-,16-,18+,19-,20-,21-/m0/s1
| Section2 = {{Chembox Properties
| C = 21
| H = 30
| O = 5
| MolarMass = 362.460 g/mol
'''Kortisol''' edo '''hidrokortisona''' [[giltzurrungaineko guruin]]aren azalak jariatzen duen [[hormona]] esteroidea da, glukokortikoideetako familiakoa. [[Kolesterol]]etik abiatuta sintetizatzen da, giltzurrungaineko guruinaren azalak jariatzen dituen beste hormonen antzera ([[aldosterona]], [[kortisona]], [[testosterona]]...).