Kolesterol: berrikuspenen arteko aldeak

Ezabatutako edukia Gehitutako edukia
Gartxoak (eztabaida | ekarpenak)
No edit summary
Etiketa: 2017 wikitestu editorearekin
1. lerroa:
{{konposatu kimiko infotaula}}
{{chembox
| Watchedfields = changed
| verifiedrevid = 477165736
| ImageFile = Cholesterol.svg
| ImageSize = 240
| ImageAlt = Egitura kimikoa
| ImageFile2 = Cholesterol molecule ball.png
| ImageSize2 = 260
| ImageAlt2 = Modeloa
| ImageFile3 = Sample of Cholesterol.jpg
| ImageSize3 = 200
| ImageAlt3 =
| IUPACName =(3β)-cholest-5-en-3-ol
| SystematicName =2,15-dimethyl-14-(1,5-dimethylhexyl)tetracyclo[8.7.0.0<sup>2,7</sup>.0<sup>11,15</sup>]heptadec-7-en-5-ol
| OtherNames =(10''R'',13''R'')-10,13-dimetil-17-(6-metilheptan-2-il)-2,3,4,7,8,9,11,12,14,15,16,17-dodekahidro-1''H''-ziklopenta[''a'']fenantren-3-ol, kolesterin, kolesteril alkohol <ref name=SciFinder>{{erreferentzia|izenburua=Substance Data for 57-88-5}}</ref>
|Section1={{Chembox Identifiers
| IUPHAR_ligand = 2718
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 97C5T2UQ7J
| InChI = 1/C27H46O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h9,18-19,21-25,28H,6-8,10-17H2,1-5H3/t19-,21+,22+,23-,24+,25+,26+,27-/m1/s1
| InChIKey = HVYWMOMLDIMFJA-DPAQBDIFBB
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 112570
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C27H46O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h9,18-19,21-25,28H,6-8,10-17H2,1-5H3/t19-,21+,22+,23-,24+,25+,26+,27-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = HVYWMOMLDIMFJA-DPAQBDIFSA-N
| CASNo =57-88-5
| CASNo_Ref = {{cascite|correct|CAS}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 5775
| PubChem =5997
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00040
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 16113
| SMILES = C[C@H](CCCC(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)O)C)C
}}
|Section2={{Chembox Properties
| Formula =C<sub>27</sub>H<sub>46</sub>O
| MolarMass =386.65 g/mol
| Appearance = beirazko hautsa<ref name=MSDS>{{erreferentzia |url=http://physchem.ox.ac.uk/MSDS/CH/cholesterol.html |izenburua=Safety (MSDS) data for cholesterol}}</ref>
| Density = 1.052 g/cm<sup>3</sup>
| MeltingPtC = 148 to 150
| MeltingPt_notes = <ref name=MSDS/>
| BoilingPtC = 360
| BoilingPt_notes = (disolbatuz)
| Solubility =1.8 mg/L (30&nbsp;°C)<ref>http://www.pnas.org/content/70/8/2313.full.pdf</ref>
| SolubleOther = [[azetona]], [[bentzeno]], [[kloroformo]], [[etanol]], [[eter]], [[hexano]], [[isopropil miristato]], [[metanol]]
}}
|Section7={{Chembox Hazards
| MainHazards =
| FlashPt =209.3 ±12.4&nbsp;°C
| FlashPt_ref =<ref name="SciFinder"/>
| AutoignitionPtC =
}}
}}
'''Kolesterola''' gorputz-ehunetan eta [[odol-plasma]]n dagoen [[esterol]]a ([[lipido]]a) da. Batez ere, [[gibel]], [[bizkarrezur-muin]], [[pankrea|are]] eta [[garun]]ean dago. Giza-gorputzaren funtzionamendurako ezinbestekoa, hainbat egitura eta organoetan hainbat funtzio betetzen ditu. Horien artean nerbio-zuntzen [[mielina]]zko bandena eta [[hormona]]k ekoizteko oinarrizkoa da.