«B8 bitamina»: berrikuspenen arteko aldeak

1.812 bytes added ,  Duela 8 urte
ez dago edizio laburpenik
t (r2.7.1) (robota Erantsia: hu:Biotin)
{{chembox
[[Fitxategi:Biotin structure.svg|thumb|Biotinaren egitura]]
| verifiedrevid = 443307462
| Name = Biotina
| Reference=<ref>''Merck Index'', 11th Edition, '''1244'''.</ref>
| ImageFile = Biotin structure JA.png
| ImageSize = 200px
| ImageFile1 = Biotin-3D-balls.png
| ImageSize2 = 200px
| IUPACName=Azido 5-[(3a''S'',4''S'',6a''R'')-2-oxohexahidro-1''H''-tieno[3,4-''d'']imidatzol-4-il]pentanoiko
| OtherNames = B<sub>7</sub> bitamina; H bitamina; R koentzima; Biopeidermo
| Section1 = {{Chembox Identifiers
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00121
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 15956
| SMILES = O=C1N[C@@H]2[C@@H](SC[C@@H]2N1)CCCCC(=O)O
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 6SO6U10H04
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00029
| InChI = 1/C10H16N2O3S/c13-8(14)4-2-1-3-7-9-6(5-16-7)11-10(15)12-9/h6-7,9H,1-5H2,(H,13,14)(H2,11,12,15)/t6-,7-,9-/m0/s1
| InChIKey = YBJHBAHKTGYVGT-ZKWXMUAHBB
| SMILES1 = C1[C@H]2[C@@H]([C@@H](S1)CCCCC(=O)O)NC(=O)N2
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 857
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C10H16N2O3S/c13-8(14)4-2-1-3-7-9-6(5-16-7)11-10(15)12-9/h6-7,9H,1-5H2,(H,13,14)(H2,11,12,15)/t6-,7-,9-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = YBJHBAHKTGYVGT-ZKWXMUAHSA-N
| CASNo = 58-85-5
| CASNo_Ref = {{cascite|correct|CAS}}
| PubChem = 171548
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 149962
| RTECS =
| ATCCode_prefix = A11
| ATCCode_suffix = HA05
}}
| Section2 = {{Chembox Properties
| C=10|H=16|N=2|O=3|S=1
| Appearance = Kristalezko orratz zuriak
| Solubility = 22 mg/100 mL
| MeltingPt = 232-233 °C
}}
| Section3 = {{Chembox Hazards
| NFPA-H = 1
| NFPA-F = 1
| NFPA-R = 0
}}
}}
 
'''B8 bitamina''', '''biotina''' edo '''H bitamina''' izenaz ere ezagutzen dena, [[bitamina]] hidrosolugarriahidrodisolbagarria eta alkoholetan solugarriadisolbagarria da, beroa ongi jasaten du eta erraz oxidatzen da. [[Karbono hidrato]], [[gantz]], [[aminoazido]] eta [[purina|purinen]] [[metabolismo]]an parte hartzen du.
 
Bere gabeziak muskuluetako mina, [[ekzema]] eta [[dermatitis]]a eragiten du. [[Depresio]]a eta logurearilogurari aurre egiteko erabiltzen da era terapeutikoan. Guztiz beharrezkoa da gantzen sintesi eta degradaziorako, eta baita zenbait [[aminoazido]] degradatzeko ere.
 
[[Karbono dioxido]]aren transferentzia-erreakzioetan jarduten du.
[[Heste]]etako flora [[bakterio|bakteriarrak]] biotina ekoizten du, baina ez giza-gorputzak eskatzen duen bezainbeste. Elikagai hauetan ugari da: [[esne]]a eta [[esneki]]etan, [[legami]]etan eta okela eta animalien erraietan.
 
Gaur egun egunero hartu beharreko B8 bitamina kopurua egunean 200-300 μg dela onartzen da. Halere, kontu honen inguruan egindako ikerketek eztuteez dute behin betiko emaitzarik eman.
 
Biotina 3 era desberdinetan agertzen da naturan: biotina aske bezala (gizakiak probestu dezakeen era bakarra), biozitina osatuaz eta sulfoxido bezala.
 
== Erreferentziak ==
{{erreferentzia_zerrenda}}
 
[[Kategoria:B taldearen bitaminak]]
[[Kategoria:Azido karboxilikoak]]
 
[[ar:بيوتين]]
190.233

edits