B anfoterizina

konposatu kimiko

B Anfoterizina onddo patogenoen aurkako botika da, Streptomyces nodosus bakterioak modu naturalean ekoizten duena. Bi anfoterizina mota daude: A anfoterizina, erabilera klinikoa ez duena, eta B anfoterizina, onddo-infekzioen aurka erabiltzen dena. Bere izenak molekula horren ezaugarri anfoterikoei aipamena egiten die.

B anfoterizina
TDKGM 01.056 Koleksi dari Perpustakaan Museum Tamansiswa Dewantara Kirti Griya.pdf
Formula kimikoa C₄₇H₇₃NO₁₇
SMILES kanonikoa 2D eredua
SMILES isomerikoa
C[C@H]1/C=C/C=C/C=C/C=C/C=C/C=C/C=C/[C@@H](C[C@H]2[C@@H]([C@H](C[C@](O2)(C[C@H](C[C@H]([C@@H](CC[C@H](C[C@H](CC(=O)O[C@H]([C@@H]([C@@H]1O)C)C)O)O)O)O)O)O)O)C(=O)O)O[C@H]3[C@H]([C@H]([C@@H]([C@H](O3)C)O)N)O
InChl 3D eredua
Mota Bakterizida eta polyenes (en) Itzuli
Masa molekularra 923,488 u
Erabilera
Tratatzen du Kokzidioidomikosi, Aspergilosi, fungal meningitis (en) Itzuli, chronic mucocutaneous candidiasis (en) Itzuli, Zistitis, Kriptokokosi, Kala-azar, Neutropenia, Peritonitis, paracoccidioidomycosis (en) Itzuli, blastomikosi, Kandidiasi, sporotrichosis (en) Itzuli, histoplasmosis (en) Itzuli, Mikosi, Gernu-infekzio, entomophthoramycosis (en) Itzuli eta cutaneous candidiasis (en) Itzuli
Haurdunaldia US pregnancy category B (en) Itzuli
Rola Entzimen inhibitzaile, Bakterio-kontrako, Amebicide (en) Itzuli, Antifungiko eta antiprotozoal (en) Itzuli
Identifikatzaileak
InChlKey APKFDSVGJQXUKY-INPOYWNPSA-N
CAS zenbakia 1397-89-3
ChemSpider 10237579
PubChem 5280965
Reaxys 4645978
Gmelin 2682
ChEMBL CHEMBL267345
ZVG 109758
EC zenbakia 215-742-2
ECHA 100.014.311
MeSH D000666
RxNorm 732
UNII 7XU7A7DROE
NDF-RT N0000145996
KEGG C06573 eta D00203

Onddoen aukako antibiotikoek, bakterioen aurkakoen aldean, oztopo garrantzitsua dute: onddoak eukariotoak direnez, haien aurka erabiltzen diren antifungikoek sarritan kalte egiten diote ostalariaren zelula eukariotoei ere, eta horrek albo-ondorio kaltegarriak eragiten ditu gaixoengan. B anfoterizinak onddoen zelula mintza kaltetezen du, mintza horrek ergosterol asko baitu eta botikak ergosterolaren egitura deusestatzen du, mintza zulatuz. Ugaztunen zelula mintzek ez dute ergosterolik, kolesterola baizik: horri esker B anfoterizinak ez die hainbeste kaltetzen. Dena den, botika maila txikiagoan kolesterolera atxikitzen da ere, eta horrek azaltzen du bere toxikatosuna eta albo-ondorio kaltegarriak, giltzurrunetan batez ere.

Bere ekintza toxikoa dela-eta, B anfoterizina onddoek eragindako infekzio larriak eta sistemikoak tratatzeko besterik ez da erabiltzen. Sukarra, goragaleak eta hotzikarak eragiten ditu, eta gaixoen %80an giltzurrun-kalteak sortzen ditu.

Digestio-aparatuan gaizki xurgatzen denez, B anfoterizina ez da aho bidetik hartzen, zain barneko bidetik baizik.

Mikosi sakon, larri eta sistemikoen aurka erabili ohi da: kandidiasi inbaditzailea, aspergilosi, Cryptococcus eta Coccidioides onddoek eragindako meningitis, HIESdunek garatzen dituzten onddo-infekzioen aurka, etab.

Kanpo estekakAldatu