Aspartamo

konposatu kimiko

Aspartamoa fenilalanina eta azido aspartikoz osatutako substantzia da, azukrearen ordezko edulkoratzaile gisa erabilia.[1] 1965ean G. D. Searle and Companyk aurkitua, Europan E-951 kodea du.

Aspartamo
Aspartame.svg
Formula kimikoaC14H18N2O5
SMILES kanonikoa2D eredua
SMILES isomerikoa
COC(=O)[C@H](CC1=CC=CC=C1)NC(=O)[C@H](CC(=O)O)N
InChl3D eredua
Osatutaoxigeno eta karbono
Masa molekularra294,122 Da
Erabilera
RolaEdulkoratzaile
Arriskuak
NFPA 704
NFPA 704.svg
1
1
0
Identifikatzaileak
InChlKeyIAOZJIPTCAWIRG-QWRGUYRKSA-N
CAS zenbakia22839-47-0
ChemSpider118630
PubChem134601
Reaxys2223850
Gmelin2877
ChEMBLCHEMBL171679
EC zenbakia245-261-3
ECHA100.041.132
CosIng32015
MeSHD001218
RxNorm1311524
Human Metabolome DatabaseHMDB0001894
UNIIZ0H242BBR1
NDF-RTN0000022565
KEGGD02381 eta C11045
PDB LigandPME

Aspartamoa azukrea baino 150 eta 200 aldiz gozoagoa da. Edulkoratzaile guztiak sakarosa edo azukre arruntarekin alderatuak sailkatzen dituzte, eta, beraz, 200 aldiz balio hori laborategian egindako %15ean diluzioekin (gozotasun erlatiboa = 100) alderatzean lortzen dute.[2]

ErreferentziakAldatu

  1. Euskalterm: [Hiztegi Terminologikoa] [2009]
  2. (Ingelesez) DuBois, Grant E.. (1991-12-31). Concentration—Response Relationships of Sweeteners A Systematic Study. 450 doi:10.1021/bk-1991-0450.ch020..

Kanpo estekakAldatu


  Artikulu hau kimikari buruzko zirriborroa da. Wikipedia lagun dezakezu edukia osatuz.