Androsterona

Testosterona baino eraginkortasun txikiagoko androgenoa. Gizonezkoaren gernuan agertzen da bereziki

Androsterona gizakiak berez sortzen duen sustantzia bat da, androgenoak ekoizteko bitartekaria dena. Egitura kimikoari dagokionez lipido esteroide bat da.

Androsterona
Androsterone.png
Formula kimikoaC19H30O2
SMILES kanonikoa2D eredua
SMILES isomerikoa
C[C@]12CC[C@H](C[C@@H]1CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CCC4=O)C)O
InChl3D eredua
Masa molekularra290,225 Da
Identifikatzaileak
InChlKeyQGXBDMJGAMFCBF-HLUDHZFRSA-N
CAS zenbakia53-41-8
ChemSpider5668
PubChem5879
Reaxys2217626
Gmelin16032
ChEBI700649
ChEMBLCHEMBL87285
EC zenbakia200-173-4
ECHA100.000.159
MeSHD000738
RxNorm1312359
Human Metabolome DatabaseHMDB0000031
UNIIC24W7J5D5R
KEGGC00523
PDB LigandAOI

JatorriaAldatu

Animalietan agertzen da baina pinuaren polenean ere aurkitzen da.

HistoriaAldatu

Adolf Butenandtek aurkitu zuen 1931 urtean. Androsterona eta progesterona aurkitu izanagatik Kimikako Nobel Saria jaso zuen 1939an. Leopold Stephan Ruzicka suitzarrak 1934an sintetizatu zuen.

ErreferentziakAldatu

Kanpo estekakAldatu